| a = abstract | |
| Acetates, ethyl, oxidation, a | 87 |
| vinyl, hydroformylation, a | 44 |
| Acetic Acid, by carbonylation of MeOH | 89, 94 |
| Cativa™ process | 94, 146 |
| Acetylenes, hydrogenation, a | 138 |
| Acrylates, methyl, for iodobenzene vinylation, a | 138 |
| ADMET, in organic synthesis | 168 |
| Alcohols, allyl, hydrogenation, a | 181 |
| by CO hydogenation | 3 |
| ethyl, sensor, in beer and wine, a | 42 |
| methyl, carbonylation, Ir/I catalysed | 89, 94 |
| over Rh/hydrotalcite, a | 88 |
| oxidation, a | 88 |
| Alfa Aesar, “High Purity Metals” catalogue | 55 |
| Alkanes, hydrogenolysis | 3 |
| Alkenes, epoxidation, a | 181 |
| hydrogenation, a | 43 |
| Alkoxycarbonylation, 4-bromoacetophenone, a | 182 |
| Alkynes, as ligands, in [Pt2Cu4(C≡CPh)8]2, a | 40 |
| Allenes, copolymerisations, a | 139 |
| Alloys, dental | 31 |
| eutectic | 158 |
| ferritic | 158 |
| high-temperature | 158 |
| jewellery | 56, 156 |
| shape memory, a | 179 |
| Allylbenzenes, by Suzuki coupling, a | 88 |
| Aluminium, Al-Ir, Al-Ni-Ru, Al-Ru, phase diagrams | 56 |
| Al-Ir-Ru, phase diagram | 56, 85 |
| Ir-IrAl, Ru-RuAl, formation | 158 |
| NdRh4Al15.37, synthesis and structure, a | 86 |
| Pt-Al-X, for high-temperature use | 158 |
| TiAl-Ru, properties of, a | 40 |
| Amidation, nitriles, with amines, a | 139 |
| Amination, 2(,5)-(di)bromothiophenes, a | 88 |
| Amines, from olefins, by hydroaminomethylation, a | 44 |
| reaction with Pd and Pt dithiocarbamates, a | 40 |
| Ammonia, coupling with CH4, HCN synthesis, a | 87 |
| in hydroaminomethylations, a | 44 |
| oxidation, in nitric acid manufacture | 74 |
| Antibacterial Agents, Ru(III) complexes, a | 140 |
| Arenes, vinyl, hydroformylation, a | 44 |
| Autocatalysts, conferences | 31, 67, 71 |
| diesel treatment | 67 |
| emission control | 22, 31, 56 |
| lean-NOx | 67 |
| selective catalytic reduction | 67, 71 |
| Benzene, ethyl-, dehydrogenation, a | 181 |
| Benzoic Acid, hetroaryl, synthesis, a | 182 |
| Biphenyl, synthesis, a | 87 |
| Bonding, pressure, using Pd-In, a | 89 |
| Book Reviews, “Catalysis by Polymer-Immobilized Metal Complexes” | 15 |
| “Catalysis from A to Z” | 167 |
| “Metals and the Royal Society” | 30 |
| S. Afr. J. Sci ., Pt in South Africa | 56 |
| Bushveld Complex, geology, Pt and Pd reserves | 33, 56 |
| Cancer, drugs | 31, 56, 140 |
| Capacitors, in electronic equipment | 107, 137, 140 |
| Carbenes, Pd, fluoroalkylated N -heterocyclic, a | 136 |
| Ru, in metathesis | 58, 112, 168 |
| Carbocycles, synthesis | 112, 138 |
| Carbon, nanotubes, electroless plating of metals onto, a | 42 |
| origins and pretreatment of, for Pd/C catalysts, a | 181 |
| Pt/C fibres, H2 adsorption, a | 135 |
| Carbon Oxides, CO2, compressed, solvent, a | 44 |
| sc-, solvent, a | 136, 180, 182 |
| CO, codeposition with Os and Ru, a | 40 |
| copolymerisation, with ethene, a | 44, 139 |
| effect on H2 permeation, of membranes, a | 85 |
| hydrogenation, to alcohols | 3 |
| living alternating copolymerisation, with allenes, a | 139 |
| for NO reduction, on Ir/support, a | 138 |
| oxidation, on anodic catalysts, for PEFCs, a | 89 |
| over Pd25Zr75, a | 87 |
| on Pt/C electrocatalysts, a | 139 |
| reaction with NO | 3 |
| relativistic effects on PGMs | 146 |
| removal from reformate, using Demonox™ unit | 108 |
| sensor, a | 137, 180 |
| in tobacco smoke, oxidation, by PGM catalysts | 120 |
| Carbonylation, MeOH | 88, 89, 94 |
| Carbonyls, OsCO+, Os(CO)x, Os(CO)x−, IR spectra, a | 40 |
| PGM clusters | 3 |
| Ru3(CO)12, decomposition, a | 87 |
| RuCO+, Ru(CO)x, Ru(CO)x−, IR spectra, a | 40 |
| Carboxylic Acids, citrate, effect on PtCl42−” reduction, a | 179 |
| Casting, lost wax, for jewellery manufacture | 156 |
| Catalysis, book reviews | 15, 56, 167 |
| combinatorial screening techniques | 16 |
| heterogeneous, a | 43, 87–88, 137–138, 181–182 |
| time resolved DRIFT studies, a | 87 |
| homogeneous, a | 44, 88–89, 138–139, 182 |
| in metathesis | 58, 112, 168 |
| relativistic phenomena, in chemistry of PGMs | 146 |
| solventless, microwave-assisted, Suzuki coupling, a | 182 |
| in subcriticai H2O, a | 138 |
| Catalysts, Adams, a | 43 |
| auto-, see Autocatalysts | |
| book reviews | 15, 56, 167 |
| Grubb’s | 168, 182 |
| model, “nanopits” and “nanotowers”, a | 138 |
| PGM/polymer, book review | 15 |
| PGMs, in HotSpot™ reformer | 108 |
| to limit tobacco related diseases | 120 |
| recovery, a | 41, 88, 138, 139 |
| recycling, a | 43, 87, 138, 181, 182 |
| “ship-in-bottle” | 3 |
| three-way, see Three-Way Catalysts | |
| Catalysts, Iridium, Ir2Si oxide, Ir3Ti oxide | 16 |
| Ir/γ-Al2O3, Ir/SiO2, Ir/silicalite, NO reduction, a | 138 |
| Catalysts, Iridium Complexes, Cativa™ process | 94 |
| Ir hydrides, low valent, for nitrile activation, a | 139 |
| Ir/I, in MeOH carbonylation | 89, 94 |
| [IrCl3(l,5-cyclooctadiene)], IrCl3, [IrCl3(cyclooctene)], [IrCl3(norbornadiene)], IrCl3.3H2O, metathesis | 58 |
| Rh/Ir/TPPTS, olefin hydroaminomethylation, a | 44 |
| Catalysts, Osmium, Os2Si oxide | 16 |
| Catalysts, Osmium Complexes, OsCl3, metathesis | 58, 168 |
| OsCl3(hydrate), OsCl3.3H2O, metathesis | 58 |
| OsHCl(CO)(O2)(PR3)2, OsHCl(CO)(PR3)2, OsHCl(CO)(PPh3)(dppp), hydrogenation, a | 139 |
| Os(II) naphthalenes, cyclisation reactions, a | 139 |
| Catalysts, Palladium, Pd1Si oxide | 16 |
| Pd25Zr75, CO oxidation, a | 87 |
| Pd-Cu/Dowex 50 W X, nitrate removal from H2O, a | 43 |
| Pd-Cu/TiO2, Pd-Cu/ZrO2, nitrate reduction | 84 |
| Pd-In, Pd-Sn, nitrate reduction | 84 |
| Pd-Pt-Ce/Al2O3, bleach plant effluent treatment, a | 43 |
| Pd-Sn/TiO2, Pd-Sn/ZrO2, nitrate reduction | 84 |
| Pd/γ-Al2O3, CF2Cl2 hydrogenolysis, a | 138 |
| Pd/Al2O3, propane oxidation, a | 138 |
| Pd/γ-Al2O3, trichloroethylene oxidation, a | 138 |
| Pd/C, acetylenes hydrogenation, a | 138 |
| iodobenzene vinylation, a | 138 |
| olefins hydrogenation, a | 138 |
| origin of C, pretreatment of C surface, a | 181 |
| Pd/C and PEG-400, aryl-aryl coupling, a | 87 |
| Pd/KF/Al2O3, Suzuki coupling, a | 182 |
| Pd/“Mg-smectite”, iodobenzene vinylation, a | 138 |
| Pd/SiO2, iodobenzene vinylation, a | 138 |
| Pd/SiO2, “nanopits”. “nanolowers”, a | 138 |
| Pd/zeolite-X, methyldecalin hydrocracking, a | 181 |
| PdCl2/clay, Suzuki coupling, a | 88 |
| Catalysts, Palladium Complexes, π-allylpalladium, a | 88 |
| (η2-C60)Pd(PPh3)2, theoretical studies, a | 88 |
| Pd carbenes, a | 136 |
| Pd + 1,3-C3H6[P(C6H3-2-OMe-5-SO3Na)2]2, a | 139 |
| Pd-wool, carbonyl hydrogenation, a | 87 |
| PdCl2/Adogen 464, oxidation of alcohols, a | 88 |
| PdCl2/polystyrene, preparation, a | 86 |
| PdCl2(PhCN)2/PPh3, in alkoxycarbonylation. a | 182 |
| Pd(OAc)2, carbocycle synthesis, a | 138 |
| Pd(OAc)2/PBut3, dibromothiophenes + diarylamines, a | 88 |
| Pd(OAc)2/P(o -tolyl)3, Suzuki coupling, a | 182 |
| [Pd(P-P)(N-N)x](PF6)2, CO + C2H4 copolymerisation, a | 44 |
| Pd(PPh3)2Cl2, Suzuki coupling, a | 182 |
| Pd(PPh3)4, in alkoxycarbonylation, a | 182 |
| coupling reactions, a | 89 |
| Suzuki coupling, a | 182 |
| (R4N)2PdX4, oxidation of alcohols, a | 88 |
| Catalysts, Platinum, Pt+ HCN synthesis, a | 87 |
| [Pt9(CO)18]2−/, [Pt12(CO)24]2−/NaY, [Pt15(CO)30]2−[NBu4]+/, [Pt15(CO)30]2− [NEt4]+/FSM-16, Pt nanoparticles/, Pt nanowires/FSM-16, WGSR | 3 |
| Pt, sputtered on gasochromic sol-gel WO3 films | 155 |
| Pt-Co/, Pt-Cu/, Pt-Fe/, Pt-Ni/, Pt-Ru/C, Pt/C/Nafion, for DMFC, a | 182 |
| Pt/, Pt-Ga/, Pt-Pb/, Pt-Sn/, Pt-Sn-Ga/Al2O3, Al2O3 + K, ZnAl2O4, propane dehydrogenation, a | 181 |
| Pt-Rh/Al2O3-CeO2, TWC, a | 137 |
| Pt/γ-Al2O3, Na-promoted, NO reduction by propene, a | 43 |
| Pt/γ-Al2O3, trichloroethylene oxidation, a | 138 |
| Pt/C electrocatalysts, CO oxidation, a | 139 |
| Pt/Ce0.68Zr0.32O2, TWC, oxygen storage capacity | 124 |
| Pt/poly(N-isopropylacrylamide)-SiO2 hydrogenation, a | 181 |
| Pt/W6+-doped TiO2, ethyl acetate oxidation, a | 87 |
| PtCl4 with Dowex® 1, alkene hydrogenation, a | 43 |
| PtO2/Al2O3, PtRuOx, colloidal (pre(catalysts, a | 43 |
| Catalysts, Rhodium, Pt-Rh/Al2O3-CeO2, TWC, a | 137 |
| Rh1 Ti oxide, Rh2Si oxide, Rh2Ti oxide | 16 |
| Rh nanoparticles/hydrotalcite, MeOH carbonylation, a | 88 |
| Rh/ZrO2-SiO2, CH4 combustion, a | 43 |
| Catalysts, Rhodium Complexes, chlorotris-(triazaphosphaadamantane)Rh(I), hydrogenation, a | 44 |
| (R )-BINAP-Rh(I), vinyl acetate hydroformylation. a | 44 |
| Rh2(OAc)4, in cyclopropanations, a | 139 |
| Rh phosphites, hex-1-ene hydroformylation, a | 182 |
| Rh (R.S )-H2F6-BINAPHOS, in hydroformylations, a | 44 |
| Rh-MeDuPHOS/PDMS, hydrogenation, a | 88 |
| Rh/Ir/TPPTS, olefin hydroaminomethylation, a | 44 |
| RhCl3, metathesis | 58 |
| (RhCl(COD)2), vitamin E synthesis, a | 182 |
| Rh(η3-CH(Ar′)C {C(=CHAr′)CH2C(=CHAr′)-CH2CH2CH=CHAr′}CH2](PPh3)2, a | 139 |
| Rh(PPh3)2LCl (L = CO, PPh3), metathesis | 58 |
| Wilkinson’s catalyst, dehydrocoupling polymerisations | 172 |
| Catalysts, Ruthenium, MoxRuySez–(CO)n, for PEFC, a | 89 |
| PtRuOx, colloidal (pre)catalysts. a | 43 |
| [PW11O39RuII(DMSO)]5−, in oxidations, a | 182 |
| Ru1 Ti oxide, Ru2Si oxide, Ru3Ti oxide | 16 |
| Ru/anion exchange resin, in H2 generation, a | 140 |
| Ru/SiO2 aerogel, for N,N -diethylformamide synthesis, a | 88 |
| Catalysts, Ruthenium Complexes, dihydridocarbonyl-Ru(PPh3)3, poly(silyl ethers) synthesis, a | 139 |
| Grubb’s catalyst | 168, 182 |
| K2RuCl5, metathesis | 58 |
| poly-cis -[Ru(vbpy)2(py)2](PF6)2, in electrocatalysis, a | 136 |
| Ru carbenes, metathesis | 58, 112, 168 |
| Ru hydrides, low valent, for nitrile activation, a | 139 |
| Ru-melanoidin, for H2 generation, from H2O, a | 137 |
| Ru(bpy)33+ + RuO2 adsorbing Ru-red, H2O oxidation, a | 44 |
| RuCl2(=CH2)(PCy3)2, RCM | 112 |
| RuCl2(=CHCH=CPh2)(PCy3)2, RCM | 112 |
| RuCl2(=CHCH=CPh2)(PR3)2, ROMP | 168 |
| RuCl2(=CHPh)(PCy3)2, metathesis | 112, 168 |
| RuCl2[Ph2P(CH2)3PPh2]2/SiO2, for N,N -diethylformamide synthesis, a | 88 |
| RuCl2(PPh3)2(=CHPh), metathesis | 58 |
| RuCl2(PPh3)3, ROMP | 168 |
| RuCl2(PR3)2(=CHC6H4CH=)RuCl2(PR3)2 ROMP | 58, 168 |
| RuCl2(PR3)2(=CHCH=CHPh), metathesis | 58 |
| [RuCl3(COD)], ROMP | 168 |
| RuCl3, RuCl3(hydrate), [RuCl3(norbomadiene)], [RuCl3(norbornene)], Ru(H2O)6(tos)2, metathesis | 58 |
| [RuH], RCM, metallacycle synthesis | 112 |
| RuHCl(CO)(PPh3)3, ADMET reactions | 168 |
| Ru(II) porphyrin-resin, alkene epoxidation, a | 181 |
| Cativa™, acetic acid manufacturing process | 94, 146 |
| Chemiluminescence, see Luminescence | |
| Chlorobenzenes, in aryl-aryl coupling, a | 87 |
| Chlorofluorocarbons, CF2Cl2, hydrogenolysis, a | 138 |
| CHP Systems, using HotSpot™ fuel reformer | 108 |
| Clusters, alloy, in MCM-41, in NaY | 3 |
| Chini, synthesis | 3 |
| PGM carbonyls, in FSM-16, in NaY | 3 |
| [Rh6(CO)15(COOMe)]−, [Ru6C(CO)16(COOMe)−, a | 179 |
| transformations to nanoparticles, in micro/mesopores | 3 |
| see also Nanoclusters | |
| Coatings, Ir oxide, for electrodes | 106 |
| for medical implants | 106 |
| multilayer, MoRu/Be, a | 140 |
| see also Deposition and Electrodeposition | |
| Colloids, Au-Pt, Pt-Au, a | 136 |
| Au/Pt, Au/Pt/Au | 14 |
| Pd, aggregation behaviour, using cryo-imaging | 111 |
| Pd-Cu, a | 135 |
| Pt, on poly(N-isopropylacrylamide)-SiO2, a | 181 |
| Combinatorial Chemistry, in heterogeneous catalysis | 16 |
| Conferences, 14th Santa Fe Symposium, Albuquerque, New Mexico, U.S.A., May, 2000 | 156 |
| First Int. Symp. on Iridium, Nashville, Tennesse, U.S.A., March. 2000 | 106 |
| Int. Symp. on Precious Metals, Kunming, China, Sept., 1999 | 31 |
| SAE, Detroit, U.S.A., March, 2000 | 67 |
| Second Int. Conf. on Health Effects from Vehicle Emissions, London, U.K., Feb., 2000 | 71 |
| Copper, CuAlPd, shape memory properties, a | 179 |
| electroless deposition, a | 42, 180 |
| Coupling Reactions, biphenyl synthesis, a | 87 |
| bis(diarylamino)thiophenes synthesis, a | 88 |
| C-N. for HCN synthesis, a | 87 |
| poly(aryleneethynylene) synthesis, a | 89 |
| see also Heck Reactions and Suzuki Couplings | |
| CRT™, for diesel emission control | 67, 71 |
| Crucibles, Ir, for crystal growth | 106 |
| Crystals, RRh2Ge2 (R = Gd, Tb, Dy), magnetism, a | 85 |
| Cycloolefins, ROMP | 58, 168 |
| Cyclopropanation, styrene with diazoindanone, a | 139 |
| Dearomatisation, naphthalenes, a | 139 |
| Decarbonylation, of Ru nitrosonaphthols, a | 136 |
| Decarboxylation, of allyl carbonates, allyl formates, allyl β-keto carboxylates, a | 88 |
| Dehydrogenation, hydrocarbons, a | 181 |
| Demonox™, CO clean-up unit, for HotSpot™ reformer | 108 |
| Dental, alloys, Pd-Ag, Pd-Au | 31 |
| Deposition, chemical fluid, of Pd, Pt, Rh, a | 180 |
| pulsed laser, of Ir thin films, a | 42 |
| of SrBi2Ta2O9 thin films, a | 89 |
| see also Coatings and Electrodeposition | |
| Dienes, addition of phenols, a | 182 |
| Diesel, emission control | 22, 67 |
| particulates, control by CRT™ | 67, 71 |
| β-Diketones, Ir(III) β-diketonates | 106, 179 |
| Ru(III) β-diketones, butadiyne bridged polymer, a | 41 |
| DNA, cleavage, a | 179 |
| Effluents, bleach plant, treatment with Pd-Pt-Ce/Al2O3, a | 43 |
| Electrical Contacts, Pd-Ge ohmic contact, to GaAs, a | 44 |
| Electrocatalysis, poly-cis -[Ru(vbpy)2(py)2](PF6)2, a | 136 |
| Electrochemistry, a | 41, 86 |
| Ir oxide films, redox reactions, a | 86 |
| lr(IV) chloro complexes, for insulin determination, a | 181 |
| Pt/Ti electrodes, voltammetric behaviour, a | 86 |
| Ru binuclear pyrazines, molecular hysteresis, a | 86 |
| Electrodeposition, of Au/Pt and Au/Pt/Au colloids | 14 |
| Ni/Pd, on Cu, a | 86 |
| Pd, for decorative and functional applications | 156 |
| platinised Ti, for electrodes, a | 86 |
| Pt, for decorative and functional applications | 156 |
| from alkaline electrolyte, a | 180 |
| Pt black, on evaporated Pt electrodes, a | 180 |
| Pt films, onto microelectrodes, a | 86 |
| Pt and W, onto Au, a | 42 |
| Rh, for decorative and functional applications | 156 |
| Sn, using IrO2-Ta2O5-SnO2/Ti electrodes, a | 137 |
| see also Coatings and Deposition | |
| Electrodeposition and Surface Coatings, a | 42, 86–87, 137, 180 |
| Electrodes, gate, Pt-SnO2. porous, in CO sensor, a | 180 |
| Ir oxide coatings | 106 |
| Ir-Ta-O, for SrBi2Ta2O9 thin film deposition, a | 89 |
| Ir-Ta-O/Ta/Si, properties, a | 89 |
| IrO2-Ta2O5-SnO2/Ti, for Sn plating, a | 137 |
| IrOx/glassy C, in insulin sensor, a | 181 |
| microjet | 21 |
| Os-gel-HRP/XOD/glassy C, biosensor, a | 181 |
| PdO, as damage markers, in RAM capacitors | 107 |
| Pt, micro-, with high surface areas, a | 86 |
| tubular, as amperometric detector, a | 87 |
| Pt+C+PTFE/C cloth, for Ni electrowinning, a | 41 |
| Pt black on evaporated Pt, preparation, a | 180 |
| Pt | WO3, EtOH sensor, a | 42 |
| Pt/Ru/poly-Si, by MOCVD, integration, a | 137 |
| Pt/Ti, voltammetric behaviour, a | 86 |
| radial flow microring | 21 |
| Ru intermetallic compounds, for spark plugs | 56 |
| Ru-Rh + poly(1,3-diaminobenzene), H2O2 detection, a | 42 |
| ultramicro-, Pt disc, Pt ring | 21 |
| Electroless Plating, Cu, a | 42, 180 |
| Pd, onto C nanotubes, using Pd-Sn activator, a | 42 |
| on porous Vycor glass, for membranes, a | 137 |
| thin films, on composite membrane, a | 43 |
| Pd activator, using dielectric barrier discharge, a | 180 |
| Pt activator, from Pt acetylacetonate films, a | 42 |
| Electronic Nose, gas emissions, detector | 57 |
| Electrowinning, Ni, using Pt+C+PTFE/C cloth anode, a | 41 |
| Emission Control, motor vehicles | 22, 31, 56, 67, 71, 124, 137 |
| Epoxidation, alkenes, a | 181 |
| Esterification, nitriles, with alcohols, a | 139 |
| Ethene, with CO, copolymerisation, a | 44, 139 |
| relativistic effects on PGMs | 146 |
| Ethers, crown, synthesis | 112 |
| Ethyl Acetate, oxidation, over Pt/W6+-doped TiO2, a | 87 |
| Extraction, PGMs | 31, 33, 56, 105 |
| Films, by chemical fluid deposition, Pd, Pt, Rh, a | 180 |
| gasochromic, sol-gel Pt (sputtered) WO3 | 155 |
| Ir oxide, redox reactions, a | 86 |
| Ir-Ta-O, by reactive sputtering, a | 89 |
| Langmuir-Blodgett, Pt loaded, porphyrins, a | 41 |
| Ni/Pd, on Cu, reaction with Sn-Pb, a | 86 |
| Pd, stress and resistivity changes, with H2, a | 40 |
| Pt, nanostructured, for microelectrodes, a | 86 |
| Pt acetylacetonate, photo-induced decomposition, a | 42 |
| PZT, a | 140 |
| see also Thin Films | |
| Formamides, N,N -diethyl-, synthesis, a | 88 |
| Fuel Cells, a | 44, 89, 139–140, 182 |
| AFC, Pd-based H2 diffusion electrodes, a | 140 |
| Pt/C-PTFE electrodes, a | 140 |
| anode exhaust gas burner, for HotSpot™ system | 108 |
| Demonox™ CO clean-up unit | 108 |
| DMFC, Pt-Co/, Pt-Cu/, Pt-Fe/. Pt-Ni/, Pt-Ru/C, Pt/C/Nafion, electrocatalysts, a | 182 |
| H2 generator, for PEMFC, a | 140 |
| HotSpot™ reformer | 108 |
| PEFC, CO oxidation, activity of anodic catalysts, a | 89 |
| MoxRuySez-(CO)n electrocatalysts for, a | 89 |
| Pt/C, Ru/C, Pt-Ru/C, anodic catalysts, a | 89 |
| PEMFC, H2 generator for, a | 140 |
| Pt | BAM® 407, a | 44 |
| Pt | Nafion, a | 89 |
| Pt | Nafion® 117, a | 44 |
| Pt/C electrocatalysts, EXAFS of CO oxidation, a | 139 |
| PtRuOx colloidal electrocatalysts, a | 43 |
| SPFC | 108 |
| Fullerenes, (η2-C60)Pd(PPh3)2, catalytic mechanism, a | 88 |
| Gasochromism, in sol-gel Pt (sputtered) WO3 films | 155 |
| Gauzes, Pt-Pd-Rh, Pt-Rh, metal surface composition | 74 |
| Geology, South Africa. | 33, 56, 105 |
| Germanium, Ru2Ge3, optical spectra, a | 135 |
| Graphite, layers, for forming Pt nanosheets, a | 135 |
| Heck Reactions, iodobenzene with methyl acrylate, a | 138 |
| Pd catalysts, without ligands, a | 138 |
| Helium, permeability, in Pd-YSZ membranes, a | 180 |
| Heterocycles, in synthesis | 112, 168 |
| Hex-1-ene, hydroformylation, a | 182 |
| “High Purity Metals”, Alfa Aesar catalogue | 55 |
| High Temperature, alloys | 158 |
| History, discovery of the Pt isotopes | 173 |
| Étienne Lenoir. | 125, 166 |
| “Metals and the Royal Society”, George Matthey, Percival Norton Johnson | 30 |
| metric system, kilogramme, metre | 125, 166 |
| HotSpot™ Reformer, fuel processor | 108 |
| Hydration, nitriles, a | 139 |
| Hydroaminomethylation, olefins, a | 44 |
| Hydrocarbons, dehydrogenation, a | 181 |
| methyldecalin, hydrocracking, a | 181 |
| traps, in emissions control | 67 |
| Hydrocracking, methyldecalin, a | 181 |
| Hydroformylation, vinyl acetate, vinyl arenes, a | 44 |
| hex-1-ene, in sc-CO2, a | 182 |
| Hydrogen, adsorption, on Pt/C fibres, a | 135 |
| chemisorption, on Pd-Re, a | 135 |
| effects, in Pd films, a | 40 |
| isotherms of internal oxidation, in Pd0.90Rh0.05Ni0.05, a | 135 |
| permeation, in Pd membranes, a | 43, 85 |
| photoevolution, via Pt-loaded LB films, a | 41 |
| production, by HotSpot™ fuel processor | 108 |
| using Ru catalysts, a | 137, 140 |
| reduction, of PtCl42−, a | 179 |
| sensor, a | 40 |
| separation, by Pd/α-Al2O3 membranes, a | 43 |
| solubility, in PdAg, PdRh, a | 179 |
| Hydrogen Cyanide, from CH4 + NH3, Pt+ mediated, a | 87 |
| Hydrogen Peroxide, detection, a | 42 |
| Hydrogenation, acetylenes, a | 138 |
| acrylonitrile-butadiene copolymers, a | 139 |
| alkenes, a | 43 |
| allyl alcohol, a | 181 |
| asymmetric, 3-methyl-2-butanone, diacetone alcohol, a | 87 |
| by PGM/polymer catalysts | 15 |
| CO | 3 |
| 1-decene, a | 43 |
| methylacetoacetate, a | 88 |
| olefins, a | 138 |
| phospholipid liposomes, a | 44 |
| Hydrogenolysis, alkanes | 3 |
| CF2Cl2, a | 138 |
| propane, a | 138 |
| Hydrosilylation, in polymerisations, a | 139 |
| Hypoxanthine, biosensor, a | 181 |
| Insulin, sensor, a | 181 |
| Intermetallics, PGM-based, high-temperature use | 158 |
| Iodobenzene, vinylation, a | 138 |
| Indium, coatings, for rocket thrusters | 106 |
| crucibles, crystal growth | 106 |
| in jewellery | 106 |
| in MOSFETs | 57 |
| refining | 106 |
| spark plugs | 106 |
| thermocouples | 106 |
| thin films, by pulse laser deposition, a | 42 |
| Iridium Alloys, Al-Ir, phase diagram | 56 |
| Al-Ir-Ru, phase diagram | 56, 85 |
| for high-temperature use | 158 |
| Ir-IrAl, eutectic, formation | 158 |
| (Ir,Ru)Al | 106 |
| Iridium Complexes, (η-C5H5)Ir(CO)2, as a ligand, a | 41 |
| Ir β-diketonates | 106, 179 |
| Ir fluoro derivatives | 106 |
| Ir(III) bis-terpyridines, pH sensitive luminescence, a | 41 |
| Ir(IV) chloro, for insulin determination, a | 181 |
| Iridium Compounds, electrodes, see Electrodes | |
| Ir oxide, coatings, for medical implants | 106 |
| hydrous, redox reactions, a | 86 |
| Ir-Ta-O, electrode material, by reactive sputtering, a | 89 |
| Iron, Fe-Ru, damping capacity | 157 |
| Isotopes, Pt, discovery of | 173 |
| Jewellery, electroplating, Pd, Pt, Rh | 156 |
| Ir additions | 106 |
| powder metallurgy | 156 |
| Pt, Pt alloys | 56, 156 |
| Pt-Au composites | 56 |
| 14th Santa Fe Symposium, manufacturing technology | 156 |
| Johnson Matthey, CRT™ diesel emission control | 67, 71 |
| Demonox™ system | 108 |
| George Matthey | 30 |
| HotSpot™ reformer | 108 |
| Percival Norton Johnson | 30 |
| “Platinum 2000” | 119 |
| selective catalytic reduction unit | 67 |
| Ketones, 4-bromoacetophenone, alkoxycarbonylation, a | 182 |
| hydrogenation, a | 87 |
| poly-, synthesis, a | 139 |
| α,β-unsaturated, epoxidation, a | 181 |
| Kondo Insulator, NdxCe3−xPt3Sb4, pressure tuning | 55 |
| Langmuir-Blodgett Films, H2 evolution, a | 41 |
| Lasers, KrF excimer, deposition of Ir thin films, a | 42 |
| LEDs, organic, from Pt porphyrins | 66 |
| Luminescence, chemi-, Rh(bpy)32+ dodemorph sensor, a | 137 |
| Ir(III) bis-terpyridines, as pH sensors, a | 41 |
| Nafion membranes, dyed with Ru(II) complexes, a | 42 |
| photo-, Pd3(acetate)6, a | 41 |
| [RhIII(phpy)2(CN)2]-, a | 136 |
| [Pt2Cu4(C≡CPh)8]2, a | 40 |
| [Ru(bipy)2(Sbipy)]2+, a | 180 |
| Magnetism, ferro-, in FePl nanocrystal superlattices, a | 135 |
| in Pr3RuO7, a | 179 |
| in RPd3S4 (R = Ce, Gd), a | 40 |
| in RRh2Ge2 (R = Gd, Tb, Dy), a | 85 |
| Medical, implants, Ir oxide coatings | 106 |
| Ru complexes, antibacterial agents, a | 140 |
| Membranes, Pd composite, for H2 separation, a | 181 |
| Pd-Ag/γ-Al2O3, preparation, a | 43 |
| Pd-modified YSZ, He permeation, a | 180 |
| Pd/α-Al2O3, for H2 separation, a | 43 |
| Pd/porous Vycor glass, preparation, a | 137 |
| Pd/stainless steel, H2 permeation, a | 85 |
| PDMS, with Rh-MeDuPHOS, a | 88 |
| Memory, capacitors, Pt/BST/Pt, /Pt/Ru, /RuO2, a | 140 |
| ferroelectric, PZT/Pt/TiN/Si and SiO2 multilayers, a | 140 |
| RAM, with PdO bottom electrode, as damage marker | 107 |
| Merensky Reef, geology | 33, 56 |
| Metallisation, Pd. Pt. Rh. chemical fluid deposition, a | 180 |
| Metathesis, acyclic diene | 168 |
| ring-closing | 112 |
| ring-opening polymerisation | 58, 168 |
| Methane, combustion, on Rh/ZrO2-SiO2, a | 43 |
| coupling with NH3, HCN synthesis, a | 87 |
| formation, during MeOH carbonylation, a | 89 |
| sensor, by SnO2/Os thin films, a | 87 |
| Metric System, history | 125, 166 |
| Michael Additions, in Os(II) complexes, a | 139 |
| Microwaves, for Suzuki couplings, a | 182 |
| for synthesis, of [PW11O39RuII(DMSO)]5−, a | 182 |
| Mining, South Africa | 33, 56, 105 |
| MISFETs, sensor, for CO detection, a | 180 |
| MOCVD, Pt/Ru, electrode structures, on poly-Si. a | 137 |
| MOSFETs, in electronic nose | 57 |
| Nanoclusters, PGM, synthesis | 3, 166 |
| Nanoparticles, AucorePtshell, PtcoreAUshell, preparation, a | 136 |
| FePt, preparation, a | 135 |
| from clusters, in micro/mesopores | 3 |
| Pd, quasi 2D, a | 85 |
| Pd(II) hexametallic cartwheel molecules, a | 41 |
| PdxCu100−x, preparation, a | 135 |
| Pt, from PtCl42−, a | 179 |
| Rh, on hydrotalcite, synthesis, a | 88 |
| Nanorods, colloids, Au/Pt. Au/Pt/Au | 14 |
| Nanosheets, Pt, between graphite layers, a | 135 |
| Nanotechnology, model Pd catalysts, a | 138 |
| Nanotubes, C. Ni-, Pd-plated, using Pd-Sn activator, a | 42 |
| Nanowires, Pt, in FSM-16 mesoporous channels | 3 |
| Naphthalenes, dearomatisation, a | 139 |
| Neodymium, NdRh4Al15.37, synthesis and structure, a | 86 |
| NdxCe3−xPt3Sb4, pressure tuning of | 55 |
| Nickel, from NiSO4, using Pt+C+PTFE/C cloth anode, a | 41 |
| Niobium, Nb50Ru50, shape memory effect, a | 85 |
| Nitrates, catalytic removal from H2O | 43, 84 |
| Nitric Acid, manufacture, gauze technology | 74 |
| Nitriles, -butadiene copolymers, hydrogenation, a | 139 |
| amidation. esterification, hydration, a | 139 |
| Nitrogen Oxides, NO, reaction with CO | 3 |
| reduction, a | 43, 138 |
| NOx, -traps, for lean-burn gasoline engines | 67 |
| lean-, catalysts | 67 |
| removal from motor vehicle emissions | 22, 67 |
| in tobacco smoke, reduction, by PGM catalysts | 120 |
| Ohmic Contacts, see Electrical Contacts | |
| Olefins, cyclo-, ROMP | 58, 168 |
| hydroaminomethylation. a | 44 |
| hydrogenation, a | 138 |
| Optical Properties, Ru2Ge3, Ru2Si3. a | 135 |
| Osmium, powders, high purity, synthesis | 31 |
| with SnO2, sensor, for CH4, a | 87 |
| Osmium Complexes, Cp(OC)2IrOs(CO)3(GeCl3)(Cl), Cp(OC)2IrOs(CO)3(X)2, a | 41 |
| electrodes. Os-gel-HRP/XOD/glassy C, biosensor, a | 181 |
| OsCO+, Os(CO)x, Os(CO)x, IR spectra, a | 40 |
| Osmosis, in Pd membrane preparation, a | 43, 137 |
| Oxidation, adamantane, a | 182 |
| alcohols, a | 88 |
| bleach plant effluents, over Pd-Pt-Ce/Al2O3, a | 43 |
| CO, a | 87, 139 |
| in tobacco smoke, by PGM catalysts | 120 |
| cyclooctene, a | 182 |
| ethyl acetate, a | 87 |
| H2O, a | 44 |
| high temperature, in Ni-Cr-Al-Y-Cr3C2 alloys, a | 40 |
| internal, in Pd0.90RH0.05Ni0.05. a | 135 |
| propane, a | 137, 138 |
| propene, a | 137 |
| toluene | 16 |
| trichloroethylene, a | 138 |
| VOCs, a | 87, 138 |
| Oxygen, sensors, a | 42 |
| Ozone, motor vehicle pollution | 22 |
| Palladium, activator, for electroless Cu plating, a | 180 |
| colloids, aggregation behaviour, cryo-imaging of | 111 |
| Cu/Ni/Pd, interfacial reaction with Sn-Pb, a | 86 |
| H2 effects on, a | 40 |
| membranes, a | 43, 85, 137, 180, 181 |
| in MOSFETs | 57 |
| nanoclusters, Au/Pd, Pd/Au, Pd/Au/Ag | 166 |
| nanoparticles, 2D, a | 85 |
| with Pd-In, pressure bonding, a | 89 |
| powders, submicron | 39 |
| thermocouples, thermoelectric behaviour, a | 137 |
| Palladium Alloys, CuAlPd, shape memory properties, a | 179 |
| membranes, a | 43 |
| nanoparticles, PdxCu100−x, a | 135 |
| Pd0.09Rh0.05Ni0.05, internal oxidation, a | 135 |
| Pd-Ag and Pd-Au, dental | 31 |
| Pd-Ge ohmic contact, to GaAs, a | 44 |
| Pd-In, for pressure bonding, a | 89 |
| Pd-Re overlayers and surfaces, H2 chemisorption, a | 135 |
| PdAg, PdRh, H solubility, a | 179 |
| Palladium Complexes, [Pd2(μ-Se)2(dppe)2], synthesis, a | 179 |
| Pd3(acetate)6, photoluminescence, a | 41 |
| [Pd3(μ3-Se)2(dppe)3]Cl2, synthesis, a | 179 |
| Pd acetate, plasma-induced chemical reduction, a | 180 |
| Pd carbenes, fluoroalkylated N -heterocyclic, a | 136 |
| Pd dithiocarbamates, reactions with amines, a | 40 |
| Pd olefins, with P ligands, properties, a | 85 |
| trans -[PdCl2(l,4-oxatellurane)2], synthesis, a | 136 |
| PdCl2/polystyrene, a | 86 |
| Pd(II) end-capped ferrocenes with thiophene spacers, a | 85 |
| Pd(II) heterobimetallics, a | 85 |
| Pd(II) hexametallic cartwheel molecules, a | 41 |
| Pd(II) porphyrins, synthesis of, as DNA cleavers, a | 179 |
| Pd(II) with C6[3,5-(CH2Y)2C6H3]6, a | 41 |
| (R4N)2PdX4, (n -Bu4N)2Pd2Cl6, a | 88 |
| Palladium Compounds, PdCl2-graphite, intercalation, a | 85 |
| PdO, damage markers, in RAMs | 107 |
| RPd3S4 (R = Ce, Gd), a | 40 |
| ZrPd3Si3, synthesis and properties, a | 86 |
| Patents | 45–48, 90–92, 141–144, 183–186 |
| pH, sensor system, a | 41 |
| Phase Diagrams, Al-Ir, Al-Ni-Ru, Al-Ru | 56 |
| Al-Ir-Ru | 56, 85 |
| Phenols, addition, to dienes, a | 182 |
| Photocatalysis, Ru-melanoidin, for H2, from H2O, a | 137 |
| Photoconversion, a | 41–42, 136–137, 180 |
| Photoluminescence, see Luminescence |
| Photoproperties, nanoparticles, AucorePtshell, PtcoreAUshell, a | 136 |
| NO-Ru complexes, with en and ox ion ligands, a | 136 |
| Pd(II) porphyrins, as DNA cleavers, a | 179 |
| Pt(trpy)Cl+ with pyrene substituent, ILCT character, a | 180 |
| [Ru(bipy)2(Sbipy)]2+, a | 180 |
| Ru(II) polypyridyls, photosensitisers for TiO2, a | 136 |
| sol-gel Pt (sputtered) WO3 films, gasochromism | 155 |
| Photoreactions, H2 evolution, using Pt LB films, a | 41 |
| [Ru(bipy)2(Sbipy)]2+, + dissolved O2, a | 180 |
| “Platinum 2000” | 119 |
| Platinum, capacitors, Pt/BST/Pt, /Pt/Ru, /RuO2, a | 140 |
| colloids, on poly(N-isopropylacrylamide)-SiO2, a | 181 |
| electrodeposition, from alkaline electrolyte, a | 180 |
| Pt films, on microelectrodes, a | 86 |
| electrodes, see Electrodes |
| gates, in SiC MOS capacitors, for gas sensors, a | 137 |
| isotopes, history of the discovery | 173 |
| jewellery | 56, 156 |
| kilogramme, metre, definitive standards for the metric system | 125, 166 |
| mining, in South Africa | 33, 56, 105 |
| in MOSFETs | 57 |
| nanoclusters, Au/Pt, Pt/Ru | 166 |
| nanoparticles, AucorePtshell, PtcoreAushell, preparation, a | 136 |
| Pt, from PtCl4,2−, a | 179 |
| nanosheets, between graphite layers, a | 135 |
| powders, submicron | 39 |
| Pt, to Ni-Cr-Al-Y-Cr3C2, effects on oxidation, a | 40 |
| Pt/C fibres, H2 adsorption, a | 135 |
| Pt/Ru, electrode structures, on poly-Si, by MOCVD, a | 137 |
| PZT/Pt/TiN/Si and SiO2 multilayers, a | 140 |
| Schottky diodes, Au/Pt/GaN, properties | 157 |
| thermal decomposition of NaCl on, a | 85 |
| thermocouples, thermoelectric behaviour, a | 137 |
| Platinum Alloys, CoPt ultrathin films, by sputtering, a | 40 |
| FePt, nanocrystal superlattices, nanoparticles, a | 135 |
| ultrathin films, by sputtering, a | 40 |
| for high-temperature use | 158 |
| jewellery | 56, 156 |
| NdxCe3−xPt3Sb4, Kondo insulator, pressure tuning | 55 |
| Pt-Al-X, for high-temperature use | 158 |
| Platinum Complexes, cancer drugs | 31, 56, 140 |
| organo-Pt(IV) polymers, by H-bonding | 118 |
| poly-Pt porphyrins, O2 sensors, a | 42 |
| [Pt2Cu4(C≡CPh)8]2, luminescence, a | 40 |
| [Pt3(μ3-Te)2(dppe)3]Cl2, synthesis, a | 179 |
| Pt acetylacetonate, photo-induced decomposition, a | 42 |
| Pt dithiocarbamates, reactions with amines, a | 40 |
| Pt porphyrins, in organic LEDs | 66 |
| trans -[PtCl2(l,4-oxatellurane)2], synthesis, a | 136 |
| PtCl42−, reduction by H2, a | 179 |
| Pt(dmg)2, ID, pressure-induced IMI transitions, a | 135 |
| Pt(II) end-capped ferrocenes with thiophene spacers, a | 85 |
| Pt(II) heterobimetallics, a | 85 |
| [PtMe2(bu2bipy)] + RCH2X, in Pt(IV) polymers | 118 |
| [PtSe4(dppe)], synthesis, a | 179 |
| Pt(trpy)Cl+ with pyrene substituent, photoproperties, a | 180 |
| Platinum Compounds, Ba4CuPt2O9, superconductors, a | 89 |
| Pt-oxide thin films, by reactive sputtering, a | 42 |
| PtCl4-graphite, by intercalation reaction, a | 135 |
| Zeise’s salt, relativistic effects | 146 |
| Platinum Group Metals, in HotSpot™ system | 108 |
| in limitation of tobacco related diseases | 120 |
| intermetallics, for high-temperature use | 158 |
| relativistic phenomena | 146 |
| Platreef, geological review | 33 |
| Pollution Control, bleach plant effluent, a | 43 |
| motor vehicles | 22, 31, 56, 67, 71, 124, 137 |
| nitrate removal, from water | 43, 139 |
| Polyketones, synthesis, a | 139 |
| Polymerisation, co-, a | 44, 139 |
| dehydrocoupling, to silphenylenesiloxanes | 172 |
| electro-, of Pt porphyrins, a | 42 |
| hydrosilylation, to poly(silyl ethers), a | 139 |
| ROMP | 58, 168 |
| Polymers, binding Pt complexes to, for cancer drugs | 56 |
| nitrile-butadiene, hydrogenation, a | 139 |
| metallisation of, a | 180 |
| organo-Pt(IV), by H-bonding | 118 |
| poly(1,3-diaminobenzene) + Ru-Rh electrode, a | 42 |
| poly(aryleneethynylene), preparation, a | 89 |
| polycyclic, synthesis | 112 |
| poly(N-isopropylacrylamide)-SiO2, Pt colloids on, a | 181 |
| poly(N-vinyl-2-pyrrolidone), in core/shell nanoclusters | 166 |
| poly(silyl ethers), synthesis, a | 139 |
| polystyrene, PdCl2 anchorage, a | 86 |
| Ru(III) β-diketone with butadiyne, a | 41 |
| silphenylenesiloxanes, synthesis | 172 |
| for supported PGM catalysts | 15 |
| unsaturated, from ROMP of cycloolefins | 58 |
| Powder Metallurgy, in jewellery manufacture | 156 |
| Powders, Os, Rh, synthesis | 31 |
| submicron, Pd and Pt, synthesis | 39 |
| Pressure Tuning, NdxCe3−x, Pt3Sb4 | 55 |
| Pt(dmg)2, ID, IMI transitions, a | 135 |
| Propane, dehydrogenation, a | 181 |
| oxidation, a | 137, 138 |
| Propene, from propane, a | 181 |
| oxidation, a | 137 |
| Propylene, from propane, a | 181 |
| Radioactivity, of Rh isotopes, drug production | 50 |
| Radionuclides, 105Rh, 105Ru | 50 |
| Radiotherapy, isotopically enriched Ir | 106 |
| 105Rh | 50 |
| Rare Earths, RRh2Ge2 (R = Gd, Tb, Dy), magnetism, a | 85 |
| RCM, in organic synthesis | 112 |
| Reactive Hot Isostatic Pressing, RuAl materials | 158 |
| Reduction, NO, a | 138 |
| of Pd/C catalysts, by H2, a | 181 |
| in subcriticai H2O, a | 138 |
| Refining, PGMs | 31, 106 |
| Relativistic Effects, on chemistry of PGMs | 146 |
| Rhenium, Pd-Re, H2 chemisorption, a | 135 |
| Rhodium, 105Rh, production | 50 |
| nanoclusters, Au/Rh | 166 |
| nanoparticles, on hydrotalcite, synthesis, a | 88 |
| powders, synthesis | 31 |
| Ru-Rh electrode, + poly(1,3-diaminobenzene), a | 42 |
| Rhodium Alloys, Pd0.90Rh0.05Ni0.05, internal oxidation, a | 135 |
| PdRh, H solubility, a | 179 |
| Rhodium Complexes, [acac(Rh)(COD)], precursor, a | 180 |
| [Rh6(CO)15(COOMe)]−, mass spectrum, a | 179 |
| [RhIII(phpy)2(CN)2]−, photoluminescence, a | 136 |
| Rh(PPh3)3Cl | 146, 172 |
| Rhodium Compounds, NdRh4Al15.37, synthesis, a | 86 |
| RRh2Ge2 (R = Gd, Tb, Dy), magnetism, a | 85 |
| Rockets, thrusters, Ir coatings | 106 |
| ROMP, in organic synthesis | 58, 168 |
| Ruthenium, additions, to Fe-Cr-Al | 158 |
| C-Ru xerogel composites, as supercapacitors, a | 41 |
| MoRu/Be multilayer coatings, a | 140 |
| particles, from decomposition of Ru3(CO)12, a | 87 |
| Pt/BST/Pt/Ru capacitors, a | 140 |
| Pt/Ru, electrode structures, on poly-Si, by MOCVD, a | 137 |
| 105Ru, for production of 105Rh | 50 |
| Ru-Rh electrode, + poly(1,3-diaminobenzene), a | 42 |
| Ruthenium Alloys, Al-Ir-Ru, phase diagram | 56, 85 |
| AI-Ni-Ru, Al-Ru, phase diagrams | 56 |
| corrosion-resistant | 56 |
| Fe-Ru, damping capacity | 157 |
| for high-temperature use | 158 |
| intermetallic, for spark plug electrodes | 56 |
| (Ir,Ru)Al | 106 |
| Nb50Ru50, shape memory effect, a | 85 |
| Pt-Ru, for jewellery | 156 |
| Ru-RuAl, eutectic, formation | 158 |
| Ta50Ru50, a | 85 |
| TiAl-Ru, properties, a | 40 |
| Ruthenium Complexes, Cp(OC)2IrRu(CO)3(SiCl3)2, a | 41 |
| NO-Ru complexes, with en and ox ion ligands, a | 136 |
| poly-cis -[Ru(vbpy)2(py)2](PF6)2, electrocatalysis, a | 136 |
| Rh(bpy)32+, chemiluminescence, dodemorph sensor, a | 137 |
| [Ru6C(CO)16(COOMe)]− mass spectrum, a | 179 |
| Ru binuclear pyrazines, molecular hysteresis, a | 86 |
| Ru nitrosonaphthols, synthesis, a | 136 |
| Ru-melanoidin, photocatalyst, H2O to H2, a | 137 |
| [Ru(bipy)2(Sbipy)]2+, photoproperties, a | 180 |
| RuCO+, Ru(CO)x, Ru(CO)x−, IR spectra, a | 40 |
| Ru(dcbpy)2(NCS)2, as Graetzel standard, a | 136 |
| Ru(dcphen)2(NCS)2, photosensitiser for TiO2, a | 136 |
| [RuHCI(PPi3)2], Grubb’s catalyst intermediate, a | 182 |
| Ru(II) porphyrin-Merrifield’s peptide resin, a | 181 |
| Ru(III) β-diketone butadiyne polymer, a | 41 |
| [Ru(L)3]2+ dyes, for luminescent Nafion membranes, a | 42 |
| RuX(EPh3) Schiff base complexes, a | 140 |
| Ruthenium Compounds, Pr3RuO7, magnetism, a | 179 |
| Pt/BST/RuO2 capacitors, a | 140 |
| Ru2Ge3, Ru2Si3, optical spectra, a | 135 |
| Ru3(CO)12, decomposition, Ru particles, RuO2 films, a | 87 |
| Schottky Diodes, Au/Pt/GaN, properties | 157 |
| Sensors, bio-, hypoxanthine, a | 181 |
| CH4, a | 87 |
| CO, a | 137, 180 |
| electronic nose, for VOCs | 57 |
| EtOH, a | 42 |
| H2 in Pd, using evanescent microwave probes, a | 40 |
| H2O2, a | 42 |
| insulin,a | 181 |
| liquid chromatography, a | 87 |
| O2, a | 42 |
| pH, a | 41 |
| propane, propylene, a | 137 |
| VOCs | 57 |
| Shape Memory Alloys, CuAlPd, a | 179 |
| Shape Memory Effect, Nb50Ru50, a | 85 |
| “Ship-in-Bottle” Catalysts, technology | 3 |
| Silicon, PZT/Pt/TiN/Si+SiO2, ferroelectric memories, a | 140 |
| Ru2Si3, optical spectra, a | 135 |
| ZrPd3Si3, synthesis and properties, a | 86 |
| Silver, PdAg, H solubility, a | 179 |
| ‘Smart’ Windows, gasochromic | 155 |
| Sodium Chloride, decomposition on hot Pt, a | 85 |
| Solar Cells, Graetzel-type, a | 136 |
| Solder, Sn-Pb, reaction with Ni/Pd, on Cu, a | 86 |
| South Africa, Pt mining | 33, 56, 105 |
| Spark Plugs, electrodes | 56, 106 |
| Sputtering, CoPt, FePt, thin films, a | 40 |
| magnetron. Ir oxide, for medical implants | 106 |
| of MoRu/Be multilayer coatings, a | 140 |
| Pd-Ag submicron films, a | 43 |
| plasma, of Pt, onto Nafion, a | 89 |
| reactive, of Ir-Ta-O films, for electrodes, a | 89 |
| of Pt-oxide thin films, a | 42 |
| Styrene, 2-diazo-l-indanone cyclopropanations, a | 139 |
| by dehydrogenation of ethylbenzene, a | 181 |
| Superalloys, ‘refractory’, PGM-based | 158 |
| Supercapacitors, C-Ru xerogel composites, a | 41 |
| Superconductivity, Ba4CuPt2O9 + F-doped YBCO, a | 89 |
| Superlattices, FePt nanocrystal, a | 135 |
| Suzuki Couplings, in organic synthesis, a | 88, 182 |
| Tantalum, Ta50Ru50, a | 85 |
| Thermocouples, Ir | 106 |
| Pd, Pt, thermoelectric behaviour, a | 137 |
| Thin Films, CoPt, FePt. by sputtering, a | 40 |
| Ir, by pulsed laser deposition, a | 42 |
| Pd-Ag, on γ-Al2O3, a | 43 |
| Pd/α-Al2O3, by electroless plating and osmosis, a | 43 |
| poly-cis -[Ru(vbpy)2(OH2)2](CIO4)2, formation, a | 136 |
| poly-cis -Ru(vbpy)2(py)2](PF6)2, electrocatalysis, a | 136 |
| Pt-oxide, by reactive sputtering, XPS study of, a | 42 |
| RuO2, from Ru3(CO)12, a | 87 |
| SrBi2Ta2O9, a | 89 |
| see also Films and Membranes | |
| Three-Way Catalysts | 31, 124, 137 |
| Tin, plating, using IrO2-Ta2O5-SnO2/Ti anode, a | 137 |
| Titanium, TiAl-Ru, properties, a | 40 |
| Tobacco, smoke, oxidation, by PGM catalysts | 120 |
| Trichloroethylene, oxidation, a | 138 |
| UG-2 Reef, geology, Pt and Pd reserves | 33, 105 |
| Vinyl Acetate, asymmetric hydroformylation, a | 44 |
| Vinyl Arenes, asymmetric hydroformylation, a | 44 |
| Vinylation, iodobenzene, a | 138 |
| Vitamin E, synthesis, a | 182 |
| VOCs, oxidation, a | 87, 138 |
| sensor | 57 |
| Water, for H2 generation, a | 137, 140 |
| nitrate removal | 43, 84 |
| oxidation, a | 44 |
| as solvent, for catalytic reactions | 138, 168 |
| Water Gas Shift Reaction, nanostructured PGM catalysts | |
| Zirconium, ZrPd3Si3, synthesis and properties, a | 86 |
